EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O11 |
| Net Charge | 0 |
| Average Mass | 460.391 |
| Monoisotopic Mass | 460.10056 |
| SMILES | COc1c(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C22H20O11/c1-30-18-13(32-22-17(27)15(25)16(26)20(33-22)21(28)29)8-11(24)14-10(23)7-12(31-19(14)18)9-5-3-2-4-6-9/h2-8,15-17,20,22,24-27H,1H3,(H,28,29)/t15-,16-,17+,20-,22+/m0/s1 |
| InChIKey | LNOHXHDWGCMVCO-NTKSAMNMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) has functional parent wogonin (CHEBI:10043) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) is a glycosyloxyflavone (CHEBI:50018) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) is a monohydroxyflavone (CHEBI:38687) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) is a monomethoxyflavone (CHEBI:25401) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) is a monosaccharide derivative (CHEBI:63367) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) is a β-D-glucosiduronic acid (CHEBI:15341) |
| wogonin 7-O-β-D-glucuronide (CHEBI:61282) is conjugate acid of wogonin 7-O-β-D-glucuronate (CHEBI:61285) |
| Incoming Relation(s) |
| wogonin 7-O-β-D-glucuronate (CHEBI:61285) is conjugate base of wogonin 7-O-β-D-glucuronide (CHEBI:61282) |
| IUPAC Name |
|---|
| 5-hydroxy-8-methoxy-4-oxo-2-phenyl-4H-chromen-7-yl β-D-glucopyranosiduronic acid |
| Synonym | Source |
|---|---|
| 5,7-dihydroxy-8-methoxyflavone 7-O-β-D-glucuronide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1337520 | Reaxys |
| Citations |
|---|