EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H]/C(C)=C1\CN(C)[C@@]2([H])Cc3c(nc4ccccc34)C(=O)C[C@]1([H])[C@]2([H])C(=O)OC |
| InChI | InChI=1S/C21H24N2O3/c1-4-12-11-23(2)17-9-15-13-7-5-6-8-16(13)22-20(15)18(24)10-14(12)19(17)21(25)26-3/h4-8,14,17,19,22H,9-11H2,1-3H3/b12-4-/t14-,17-,19-/m0/s1 |
| InChIKey | TYPMTMPLTVSOBU-XJHWFDBESA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vobasine (CHEBI:10015) has functional parent perivine (CHEBI:141937) |
| vobasine (CHEBI:10015) has parent hydride vobasan (CHEBI:36372) |
| vobasine (CHEBI:10015) has role antiviral agent (CHEBI:22587) |
| vobasine (CHEBI:10015) is a alkaloid ester (CHEBI:38481) |
| vobasine (CHEBI:10015) is a cyclic ketone (CHEBI:3992) |
| vobasine (CHEBI:10015) is a indole alkaloid (CHEBI:38958) |
| vobasine (CHEBI:10015) is a methyl ester (CHEBI:25248) |
| vobasine (CHEBI:10015) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| methyl 3-oxovobasan-17-oate |
| Synonyms | Source |
|---|---|
| 3-oxovobasan-17-oic acid, methyl ester | ChemIDplus |
| Vobasine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| vobasine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001786 | KNApSAcK |
| C09253 | KEGG COMPOUND |
| US2007232588 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:95955 | Beilstein |
| CAS:2134-83-0 | KEGG COMPOUND |
| CAS:2134-83-0 | ChemIDplus |
| Citations |
|---|