EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | [H]/C(C)=C1\CN(C)[C@]2([H])Cc3c(nc4ccccc34)CC[C@]1([H])[C@]2([H])C |
| InChI | InChI=1S/C20H26N2/c1-4-14-12-22(3)20-11-17-16-7-5-6-8-18(16)21-19(17)10-9-15(14)13(20)2/h4-8,13,15,20-21H,9-12H2,1-3H3/b14-4-/t13-,15+,20+/m0/s1 |
| InChIKey | IXXKGILOHWFLII-WASXRUECSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vobasan (CHEBI:36372) is a indole alkaloid (CHEBI:38958) |
| vobasan (CHEBI:36372) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| vobasine (CHEBI:10015) has parent hydride vobasan (CHEBI:36372) |
| IUPAC Name |
|---|
| vobasan |