EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141937 - perivine
| Formula | C20H22N2O3 |
| Net Charge | 0 |
| Average Mass | 338.407 |
| Monoisotopic Mass | 338.16304 |
| SMILES | [H]/C(C)=C1\CN[C@@]2([H])Cc3c(nc4ccccc34)C(=O)C[C@]1([H])[C@]2([H])C(=O)OC |
| InChI | InChI=1S/C20H22N2O3/c1-3-11-10-21-16-8-14-12-6-4-5-7-15(12)22-19(14)17(23)9-13(11)18(16)20(24)25-2/h3-7,13,16,18,21-22H,8-10H2,1-2H3/b11-3-/t13-,16-,18-/m0/s1 |
| InChIKey | NKTORRNHKYVXSU-XXMLWKDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catharanthus roseus (ncbitaxon:4058) | leaf (BTO:0000713) | PubMed (25665941) | |
| Tabernaemontana dichotoma (IPNI:60466173-2) | leaf (BTO:0000713) | PubMed (17404903) | |
| Tabernaemontana bufalina (ncbitaxon:403123) | - | PubMed (17402121) | Species also known as Ervatamia hainanensis. |
| Tabernaemontana holstii (IPNI:82153-1) | Root (BTO:0001188) | PubMed (561182) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perivine (CHEBI:141937) has role plant metabolite (CHEBI:76924) |
| perivine (CHEBI:141937) is a alkaloid ester (CHEBI:38481) |
| perivine (CHEBI:141937) is a cyclic ketone (CHEBI:3992) |
| perivine (CHEBI:141937) is a indole alkaloid (CHEBI:38958) |
| perivine (CHEBI:141937) is a methyl ester (CHEBI:25248) |
| perivine (CHEBI:141937) is a organic heterotetracyclic compound (CHEBI:38163) |
| perivine (CHEBI:141937) is conjugate base of perivine(1+) (CHEBI:194556) |
| Incoming Relation(s) |
| vobasine (CHEBI:10015) has functional parent perivine (CHEBI:141937) |
| perivine(1+) (CHEBI:194556) is conjugate acid of perivine (CHEBI:141937) |
| IUPAC Name |
|---|
| methyl (2S,5E,6R,14S)-5-ethylidene-8-oxo-2,3,4,5,6,7,8,9-octahydro-1H-2,6-methanoazecino[5,4-b]indole-14-carboxylate |
| Synonyms | Source |
|---|---|
| perivin | ChEBI |
| 4-demethyl-3-oxovobasan-17-oic acid methyl ester | ChEBI |
| Citations |
|---|