EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O |
| Net Charge | 0 |
| Average Mass | 267.332 |
| Monoisotopic Mass | 267.13716 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(N)=O)CN2C |
| InChI | InChI=1S/C16H17N3O/c1-19-8-10(16(17)20)5-12-11-3-2-4-13-15(11)9(7-18-13)6-14(12)19/h2-5,7,10,14,18H,6,8H2,1H3,(H2,17,20)/t10-,14-/m1/s1 |
| InChIKey | GENAHGKEFJLNJB-QMTHXVAHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysergamide (CHEBI:4819) has parent hydride ergoline (CHEBI:38484) |
| lysergamide (CHEBI:4819) is a ergoline alkaloid (CHEBI:60529) |
| Incoming Relation(s) |
| lysergic acid diethylamide (CHEBI:6605) has functional parent lysergamide (CHEBI:4819) |
| IUPAC Name |
|---|
| (8R)-9,10-didehydro-6-methylergoline-8-carboxamide |
| Synonyms | Source |
|---|---|
| Ergine | KEGG COMPOUND |
| Lysergamide | KEGG COMPOUND |
| (+)-lysergamide | ChemIDplus |
| lysergic acid amide | ChemIDplus |
| 9,10-didehydro-6-methylergoline-8β-carboxamide | ChEBI |