EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O |
| Net Charge | 0 |
| Average Mass | 323.440 |
| Monoisotopic Mass | 323.19976 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N(CC)CC)CN2C |
| InChI | InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
| InChIKey | VAYOSLLFUXYJDT-RDTXWAMCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. dopamine agonist A drug that binds to and activates dopamine receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. dopamine agonist A drug that binds to and activates dopamine receptors. hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysergic acid diethylamide (CHEBI:6605) has functional parent lysergamide (CHEBI:4819) |
| lysergic acid diethylamide (CHEBI:6605) has role dopamine agonist (CHEBI:51065) |
| lysergic acid diethylamide (CHEBI:6605) has role hallucinogen (CHEBI:35499) |
| lysergic acid diethylamide (CHEBI:6605) has role serotonergic agonist (CHEBI:35941) |
| lysergic acid diethylamide (CHEBI:6605) is a ergoline alkaloid (CHEBI:60529) |
| lysergic acid diethylamide (CHEBI:6605) is a monocarboxylic acid amide (CHEBI:29347) |
| lysergic acid diethylamide (CHEBI:6605) is a organic heterotetracyclic compound (CHEBI:38163) |
| Incoming Relation(s) |
| LSD-d3 (CHEBI:194178) has functional parent lysergic acid diethylamide (CHEBI:6605) |
| IUPAC Name |
|---|
| (8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide |
| Synonyms | Source |
|---|---|
| N,N-diethyl-(+)-lysergamide | NIST Chemistry WebBook |
| N,N-diethyllysergamide | NIST Chemistry WebBook |
| N,N-diethyl-D-lysergamide | ChemIDplus |
| (+)-LSD | NIST Chemistry WebBook |
| LSD | KEGG COMPOUND |
| LSD 25 | NIST Chemistry WebBook |
| Citations |
|---|