EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17728 - S-methyl-L-methionine
| Formula | C6H14NO2S |
| Net Charge | +1 |
| Average Mass | 164.250 |
| Monoisotopic Mass | 164.07398 |
| SMILES | C[S+](C)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/p+1/t5-/m0/s1 |
| InChIKey | YDBYJHTYSHBBAU-YFKPBYRVSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methyl-L-methionine (CHEBI:17728) has role Escherichia coli metabolite (CHEBI:76971) |
| S-methyl-L-methionine (CHEBI:17728) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| S-methyl-L-methionine (CHEBI:17728) is a sulfonium compound (CHEBI:26830) |
| S-methyl-L-methionine (CHEBI:17728) is conjugate acid of S-methyl-L-methioninate (CHEBI:67050) |
| S-methyl-L-methionine (CHEBI:17728) is tautomer of S-methyl-L-methionine zwitterion (CHEBI:58252) |
| Incoming Relation(s) |
| S-methyl-L-methioninate (CHEBI:67050) is conjugate base of S-methyl-L-methionine (CHEBI:17728) |
| S-methyl-L-methionine zwitterion (CHEBI:58252) is tautomer of S-methyl-L-methionine (CHEBI:17728) |
| IUPAC Names |
|---|
| [(3S)-3-amino-3-carboxypropyl](dimethyl)sulfonium |
| S-methyl-L-methionine |
| Synonyms | Source |
|---|---|
| S-Methyl-L-methionine | KEGG COMPOUND |
| L-Methionine methylsulfonium | ChEBI |