EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO2S |
| Net Charge | +1 |
| Average Mass | 164.250 |
| Monoisotopic Mass | 164.07398 |
| SMILES | C[S+](C)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2S/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/p+1/t5-/m0/s1 |
| InChIKey | YDBYJHTYSHBBAU-YFKPBYRVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methyl-L-methionine zwitterion (CHEBI:58252) is a sulfonium compound (CHEBI:26830) |
| S-methyl-L-methionine zwitterion (CHEBI:58252) is tautomer of S-methyl-L-methionine (CHEBI:17728) |
| Incoming Relation(s) |
| S-methyl-L-methionine (CHEBI:17728) is tautomer of S-methyl-L-methionine zwitterion (CHEBI:58252) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-(dimethylsulfaniumyl)butanoate |
| UniProt Name | Source |
|---|---|
| S-methyl-L-methionine | UniProt |