EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16347 - (R)-carnitine
| Formula | C7H15NO3 |
| Net Charge | 0 |
| Average Mass | 161.201 |
| Monoisotopic Mass | 161.10519 |
| SMILES | C[N+](C)(C)C[C@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | PHIQHXFUZVPYII-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-carnitine (CHEBI:16347) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (R)-carnitine (CHEBI:16347) has role antilipemic drug (CHEBI:35679) |
| (R)-carnitine (CHEBI:16347) has role nootropic agent (CHEBI:66980) |
| (R)-carnitine (CHEBI:16347) has role nutraceutical (CHEBI:50733) |
| (R)-carnitine (CHEBI:16347) has role water-soluble vitamin (role) (CHEBI:27314) |
| (R)-carnitine (CHEBI:16347) is a carnitine (CHEBI:17126) |
| (R)-carnitine (CHEBI:16347) is conjugate base of (R)-carnitinium (CHEBI:39547) |
| (R)-carnitine (CHEBI:16347) is enantiomer of (S)-carnitine (CHEBI:11060) |
| Incoming Relation(s) |
| (R)-carnitinamide (CHEBI:17159) has functional parent (R)-carnitine (CHEBI:16347) |
| (3R)-4-(dimethylammonio)-3-hydroxybutanoate (CHEBI:183234) has functional parent (R)-carnitine (CHEBI:16347) |
| O-acyl-L-carnitine (CHEBI:75659) has functional parent (R)-carnitine (CHEBI:16347) |
| (R)-carnitinium (CHEBI:39547) is conjugate acid of (R)-carnitine (CHEBI:16347) |
| (S)-carnitine (CHEBI:11060) is enantiomer of (R)-carnitine (CHEBI:16347) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-4-(trimethylammonio)butanoate |
| Synonyms | Source |
|---|---|
| L-Carnitine | KEGG COMPOUND |
| Vitamin BT | KEGG COMPOUND |
| Levocarnitine | ChemIDplus |
| (-)-Carnitine | ChemIDplus |
| (-)-L-Carnitine | ChemIDplus |
| Carnitine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Carnicor | ChEBI |
| Carnitor | DrugBank |
| Carnitene | ChEBI |
| Karnitin | DrugBank |
| UniProt Name | Source |
|---|---|
| (R)-carnitine | UniProt |