EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO3 |
| Net Charge | 0 |
| Average Mass | 147.174 |
| Monoisotopic Mass | 147.08954 |
| SMILES | C[NH+](C)C[C@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C6H13NO3/c1-7(2)4-5(8)3-6(9)10/h5,8H,3-4H2,1-2H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | NXDDNODAJKZARA-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-4-(dimethylammonio)-3-hydroxybutanoate (CHEBI:183234) has functional parent (R)-carnitine (CHEBI:16347) |
| (3R)-4-(dimethylammonio)-3-hydroxybutanoate (CHEBI:183234) is a butyrate (CHEBI:17968) |
| Synonym | Source |
|---|---|
| L-norcarnitine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (3R)-4-(dimethylamino)-3-hydroxybutanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-24803 | MetaCyc |
| Citations |
|---|