EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16704 - uridine
| Formula | C9H12N2O6 |
| Net Charge | 0 |
| Average Mass | 244.203 |
| Monoisotopic Mass | 244.06954 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | DRTQHJPVMGBUCF-XVFCMESISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uridine (CHEBI:16704) has functional parent uracil (CHEBI:17568) |
| uridine (CHEBI:16704) has role antineoplastic agent (CHEBI:35610) |
| uridine (CHEBI:16704) has role antipsychotic agent (CHEBI:35476) |
| uridine (CHEBI:16704) has role drug metabolite (CHEBI:49103) |
| uridine (CHEBI:16704) has role fundamental metabolite (CHEBI:78675) |
| uridine (CHEBI:16704) has role human metabolite (CHEBI:77746) |
| uridine (CHEBI:16704) has role ophthalmology drug (CHEBI:66981) |
| uridine (CHEBI:16704) is a uridines (CHEBI:27242) |
| Incoming Relation(s) |
| (5'S,6'R)-C-glycyluridine zwitterion (CHEBI:195553) has functional parent uridine (CHEBI:16704) |
| (5'S,6'S)-C-glycyluridine zwitterion (CHEBI:229461) has functional parent uridine (CHEBI:16704) |
| 3'-(enolpyruvyl)uridine 5'-monophosphate (CHEBI:133864) has functional parent uridine (CHEBI:16704) |
| 5-aminomethyl-2-thiouridine (CHEBI:73768) has functional parent uridine (CHEBI:16704) |
| 5'-O-(dihydroxyphosphanyl)-2'-O-{2-[2-(dimethylamino)ethoxy]ethyl}-5-methyluridine (CHEBI:39913) has functional parent uridine (CHEBI:16704) |
| nikkomycin Z (CHEBI:623918) has functional parent uridine (CHEBI:16704) |
| uridine-5'-carboxamide (CHEBI:195554) has functional parent uridine (CHEBI:16704) |
| uridine residue (CHEBI:73747) is substituent group from uridine (CHEBI:16704) |
| IUPAC Name |
|---|
| uridine |
| Synonyms | Source |
|---|---|
| 1-.beta.-d-ribofuranosyluracil | ChEMBL |
| 1-β-D-ribofuranosylpyrimidine-2,4(1H,3H)-dione | ChEBI |
| 1-β-D-ribofuranosyluracil | HMDB |
| NSC-20256 | ChEMBL |
| u | ChEBI |
| Uracil riboside | ChEMBL |
| UniProt Name | Source |
|---|---|
| uridine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00019674 | KNApSAcK |
| C00299 | KEGG COMPOUND |
| DB02745 | DrugBank |
| ECMDB00296 | ECMDB |
| HMDB0000296 | HMDB |
| URI | PDBeChem |
| Uridine | Wikipedia |
| URIDINE | MetaCyc |
| YMDB00127 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:397474 | Gmelin |
| Reaxys:754904 | Reaxys |
| CAS:58-96-8 | ChemIDplus |
| CAS:58-96-8 | KEGG COMPOUND |
| Citations |
|---|