EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N5O10 |
| Net Charge | 0 |
| Average Mass | 495.445 |
| Monoisotopic Mass | 495.16014 |
| SMILES | [H][C@]1([C@H](NC(=O)[C@@H](N)[C@H](C)[C@H](O)c2ccc(O)cn2)C(=O)O)O[C@@H](n2ccc(=O)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25N5O10/c1-7(13(28)9-3-2-8(26)6-22-9)11(21)17(31)24-12(19(32)33)16-14(29)15(30)18(35-16)25-5-4-10(27)23-20(25)34/h2-7,11-16,18,26,28-30H,21H2,1H3,(H,24,31)(H,32,33)(H,23,27,34)/t7-,11-,12-,13-,14-,15+,16+,18+/m0/s1 |
| InChIKey | WWJFFVUVFNBJTN-VHDFTHOZSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 2.4.1.16 (chitin synthase) inhibitor A EC 2.4.1.* (hexosyltransferase) inhibitor that inhibits the action of chitin synthase (EC 2.4.1.16). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nikkomycin Z (CHEBI:623918) has functional parent uridine (CHEBI:16704) |
| nikkomycin Z (CHEBI:623918) has role antifungal agent (CHEBI:35718) |
| nikkomycin Z (CHEBI:623918) is a nikkomycin (CHEBI:59668) |
| Synonyms | Source |
|---|---|
| (2S)-{[(2S,3S,4S)-2-amino-4-hydroxy-4-(5-hydroxypyridin-2-yl)-3-methylbutanoyl]amino}[(2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]acetic acid | ChEBI |
| (2S)-{[(2S,3S,4S)-2-amino-4-hydroxy-4-(5-hydroxypyridin-2-yl)-3-methylbutanoyl]amino}-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-β-D-allo-furanuronic acid | ChEBI |
| Neopolyoxin C | ChemIDplus |
| Nikkomycin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4303204 | Reaxys |
| CAS:59456-70-1 | ChemIDplus |
| Citations |
|---|