EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10NO2S |
| Net Charge | -1 |
| Average Mass | 148.207 |
| Monoisotopic Mass | 148.04377 |
| SMILES | CSCCC(N)C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/p-1 |
| InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methioninate (CHEBI:32644) is a sulfur-containing amino-acid anion (CHEBI:63470) |
| methioninate (CHEBI:32644) is a α-amino-acid anion (CHEBI:33558) |
| methioninate (CHEBI:32644) is conjugate base of methionine (CHEBI:16811) |
| Incoming Relation(s) |
| D-methioninate (CHEBI:32637) is a methioninate (CHEBI:32644) |
| L-methioninate (CHEBI:32631) is a methioninate (CHEBI:32644) |
| methionine (CHEBI:16811) is conjugate acid of methioninate (CHEBI:32644) |
| IUPAC Name |
|---|
| methioninate |
| Synonyms | Source |
|---|---|
| 2-amino-4-(methylsulfanyl)butanoate | IUPAC |
| methionine anion | JCBN |
| met− | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:326565 | Gmelin |
| Reaxys:3937270 | Reaxys |