EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9380 - syringin
| Formula | C17H24O9 |
| Net Charge | 0 |
| Average Mass | 372.370 |
| Monoisotopic Mass | 372.14203 |
| SMILES | COc1cc(/C=C/CO)cc(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3+/t12-,13-,14+,15-,17+/m1/s1 |
| InChIKey | QJVXKWHHAMZTBY-GCPOEHJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringin (CHEBI:9380) has functional parent trans-sinapyl alcohol (CHEBI:64557) |
| syringin (CHEBI:9380) has role anti-inflammatory agent (CHEBI:67079) |
| syringin (CHEBI:9380) has role antidepressant (CHEBI:35469) |
| syringin (CHEBI:9380) has role apoptosis inducer (CHEBI:68495) |
| syringin (CHEBI:9380) has role autophagy inducer (CHEBI:138880) |
| syringin (CHEBI:9380) has role hepatoprotective agent (CHEBI:62868) |
| syringin (CHEBI:9380) has role neuroprotective agent (CHEBI:63726) |
| syringin (CHEBI:9380) has role plant metabolite (CHEBI:76924) |
| syringin (CHEBI:9380) is a dimethoxybenzene (CHEBI:51681) |
| syringin (CHEBI:9380) is a monosaccharide derivative (CHEBI:63367) |
| syringin (CHEBI:9380) is a primary alcohol (CHEBI:15734) |
| syringin (CHEBI:9380) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[(1E)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 4-[(1E)-3-hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl β-D-glucopyranoside | ChEBI |
| beta-Terpineol | ChemIDplus |
| eleutheroside B | KEGG COMPOUND |
| eleutheroside B | ChemIDplus |
| (E)-sinapyl alcohol 4-glucoside | ChEBI |
| ligustrin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-O-(β-D-glucosyl)-trans-4-sinapoyl alcohol | UniProt |
| Citations |
|---|