EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O8 |
| Net Charge | 0 |
| Average Mass | 332.264 |
| Monoisotopic Mass | 332.05322 |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C16H12O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,17-19,21-22H,1H3 |
| InChIKey | JMIFIYIEXODVTO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| patuletin (CHEBI:75164) has functional parent quercetagetin (CHEBI:8695) |
| patuletin (CHEBI:75164) has role analgesic (CHEBI:35480) |
| patuletin (CHEBI:75164) has role antioxidant (CHEBI:22586) |
| patuletin (CHEBI:75164) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| patuletin (CHEBI:75164) has role lipoxygenase inhibitor (CHEBI:35856) |
| patuletin (CHEBI:75164) has role metabolite (CHEBI:25212) |
| patuletin (CHEBI:75164) is a flavonols (CHEBI:28802) |
| patuletin (CHEBI:75164) is a monomethoxyflavone (CHEBI:25401) |
| patuletin (CHEBI:75164) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone | ChemIDplus |
| 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one | HMDB |
| 3',4',5,7-Tetrahydroxy-6-methoxyflavonol | HMDB |
| 3,5,7,3',4'-Pentahydroxy-6-methoxyflavone | LIPID MAPS |
| 6-Methoxyquercetin | LIPID MAPS |
| 6-O-Methylquercetagetin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00004680 | KNApSAcK |
| C10118 | KEGG COMPOUND |
| CPD-14907 | MetaCyc |
| HMDB0030802 | HMDB |
| LMPK12112986 | LIPID MAPS |
| Patuletin | Wikipedia |
| US5858371 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:335897 | Reaxys |
| CAS:519-96-0 | KEGG COMPOUND |
| CAS:519-96-0 | ChemIDplus |
| Citations |
|---|