EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | PXGPLTODNUVGFL-NAPLMKITSA-N |
| Roles Classification |
|---|
| Applications: | biomarker A substance used as an indicator of a biological state. bronchoconstrictor agent A drug which causes a narrowing of the lumen of a bronchus or bronchiole. vasoconstrictor agent Drug used to cause constriction of the blood vessels. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-epi-prostaglandin F2α (CHEBI:34505) has functional parent prostaglandin F2α (CHEBI:15553) |
| 8-epi-prostaglandin F2α (CHEBI:34505) has role biomarker (CHEBI:59163) |
| 8-epi-prostaglandin F2α (CHEBI:34505) has role bronchoconstrictor agent (CHEBI:50141) |
| 8-epi-prostaglandin F2α (CHEBI:34505) has role vasoconstrictor agent (CHEBI:50514) |
| 8-epi-prostaglandin F2α (CHEBI:34505) is a F2-isoprostane (CHEBI:142058) |
| 8-epi-prostaglandin F2α (CHEBI:34505) is conjugate acid of 8-epi-prostaglandin F2α(1−) (CHEBI:77768) |
| Incoming Relation(s) |
| 1-palmitoyl-2-(8-epi-prostaglandin F2α)-sn-glycero-3-phosphocholine (CHEBI:77328) has functional parent 8-epi-prostaglandin F2α (CHEBI:34505) |
| 1-stearoyl-2-(8-epi-prostaglandin F2α)-sn-glycero-3-phosphocholine (CHEBI:77329) has functional parent 8-epi-prostaglandin F2α (CHEBI:34505) |
| 8-epi-prostaglandin F2α(1−) (CHEBI:77768) is conjugate base of 8-epi-prostaglandin F2α (CHEBI:34505) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α,15-trihydroxy-8β-prosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 8-epi-PGF2alpha | ChemIDplus |
| 8-epi-Prostaglandin F2alpha | KEGG COMPOUND |
| 8-Epi-prostaglandin F2alpha | ChemIDplus |
| 8-Epiprostaglandin F2alpha | ChemIDplus |
| 8-IsoP | ChEBI |
| 8-Iso-PGF2a | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C13809 | KEGG COMPOUND |
| HMDB0005083 | HMDB |
| LMFA03110001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7170215 | Reaxys |
| CAS:27415-26-5 | ChemIDplus |
| Citations |
|---|