EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O5 |
| Net Charge | -1 |
| Average Mass | 353.479 |
| Monoisotopic Mass | 353.23335 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](C/C=C\CCCC(=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/p-1/b7-4-,13-12+/t15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | PXGPLTODNUVGFL-NAPLMKITSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-epi-prostaglandin F2α(1−) (CHEBI:77768) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 8-epi-prostaglandin F2α(1−) (CHEBI:77768) is conjugate base of 8-epi-prostaglandin F2α (CHEBI:34505) |
| Incoming Relation(s) |
| 8-iso-prostaglandin F2α-glucuronide(2−) (CHEBI:229786) has functional parent 8-epi-prostaglandin F2α(1−) (CHEBI:77768) |
| 8-iso-13,14-dihydro-15-keto-PGF2alpha(1-) (CHEBI:747152) has functional parent 8-epi-prostaglandin F2α(1−) (CHEBI:77768) |
| 8-epi-prostaglandin F2α (CHEBI:34505) is conjugate acid of 8-epi-prostaglandin F2α(1−) (CHEBI:77768) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α,15-trihydroxy-8β-prosta-5,13-dien-1-oate |
| UniProt Name | Source |
|---|---|
| 8-iso-prostaglandin F2α | UniProt |