EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](O)C(C)C |
| InChI | InChI=1S/C27H46O2/c1-17(2)25(29)11-6-18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25,28-29H,6,8-16H2,1-5H3/t18-,20+,21+,22-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | IOWMKBFJCNLRTC-XWXSNNQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (20671299) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (15061359) | ||
| blood serum (BTO:0000133) | PubMed (25539717) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-24-hydroxycholesterol (CHEBI:34310) has role biomarker (CHEBI:59163) |
| (24S)-24-hydroxycholesterol (CHEBI:34310) has role human blood serum metabolite (CHEBI:85234) |
| (24S)-24-hydroxycholesterol (CHEBI:34310) has role mouse metabolite (CHEBI:75771) |
| (24S)-24-hydroxycholesterol (CHEBI:34310) is a 24-hydroxycholesterol (CHEBI:50515) |
| Incoming Relation(s) |
| (24S)-24-hydroxycholesterol ester (CHEBI:82869) has functional parent (24S)-24-hydroxycholesterol (CHEBI:34310) |
| (24S)-hydroxycholesterol 24-sulfate (CHEBI:137385) has functional parent (24S)-24-hydroxycholesterol (CHEBI:34310) |
| (24S)-hydroxycholesterol 3-sulfate (CHEBI:137388) has functional parent (24S)-24-hydroxycholesterol (CHEBI:34310) |
| (24S)-hydroxycholesterol 3,24-disulfate (CHEBI:137389) has functional parent (24S)-24-hydroxycholesterol (CHEBI:34310) |
| IUPAC Name |
|---|
| (24S)-cholest-5-ene-3β,24-diol |
| Synonyms | Source |
|---|---|
| 24-Hydroxycholesterol | KEGG COMPOUND |
| 24S-hydroxy-cholesterol | LIPID MAPS |
| 24S-hydroxycholesterol | HMDB |
| 24(S)-hydroxycholesterol | ChEBI |
| 24(S)-hydroxycholesterol | HMDB |
| 24S-OHC | ChEBI |
| UniProt Name | Source |
|---|---|
| (24S)-hydroxycholesterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 108790 | ChemSpider |
| C13550 | KEGG COMPOUND |
| CPD-7239 | MetaCyc |
| FDB022611 | FooDB |
| HMDB0001419 | HMDB |
| LMST01010019 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3218472 | Beilstein |
| CAS:474-73-7 | ChemIDplus |
| CAS:474-73-7 | KEGG COMPOUND |
| Citations |
|---|