EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O8S2 |
| Net Charge | 0 |
| Average Mass | 562.791 |
| Monoisotopic Mass | 562.26341 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OS(=O)(=O)O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](OS(=O)(=O)O)C(C)C |
| InChI | InChI=1S/C27H46O8S2/c1-17(2)25(35-37(31,32)33)11-6-18(3)22-9-10-23-21-8-7-19-16-20(34-36(28,29)30)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25H,6,8-16H2,1-5H3,(H,28,29,30)(H,31,32,33)/t18-,20+,21+,22-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | ASFDNKQCXMJFKH-XWXSNNQWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-hydroxycholesterol 3,24-disulfate (CHEBI:137389) has functional parent (24S)-24-hydroxycholesterol (CHEBI:34310) |
| (24S)-hydroxycholesterol 3,24-disulfate (CHEBI:137389) is a steroid sulfate (CHEBI:16158) |
| (24S)-hydroxycholesterol 3,24-disulfate (CHEBI:137389) is conjugate acid of (24S)-hydroxycholesterol 3,24-disulfate(2−) (CHEBI:136568) |
| Incoming Relation(s) |
| (24S)-hydroxycholesterol 3,24-disulfate(2−) (CHEBI:136568) is conjugate base of (24S)-hydroxycholesterol 3,24-disulfate (CHEBI:137389) |
| IUPAC Names |
|---|
| 24-OHChol-3,24-disulfate |
| (3β,24S)-cholest-5-ene-3,24-diyl bis(hydrogen sulfate) |
| Citations |
|---|