EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O5S |
| Net Charge | 0 |
| Average Mass | 482.727 |
| Monoisotopic Mass | 482.30660 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](OS(=O)(=O)O)C(C)C |
| InChI | InChI=1S/C27H46O5S/c1-17(2)25(32-33(29,30)31)11-6-18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25,28H,6,8-16H2,1-5H3,(H,29,30,31)/t18-,20+,21+,22-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | ZNASARDBUYPQRC-XWXSNNQWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-hydroxycholesterol 24-sulfate (CHEBI:137385) has functional parent (24S)-24-hydroxycholesterol (CHEBI:34310) |
| (24S)-hydroxycholesterol 24-sulfate (CHEBI:137385) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (24S)-hydroxycholesterol 24-sulfate (CHEBI:137385) is a steroid sulfate (CHEBI:16158) |
| (24S)-hydroxycholesterol 24-sulfate (CHEBI:137385) is conjugate acid of (24S)-hydroxycholesterol 24-sulfate(1−) (CHEBI:136566) |
| Incoming Relation(s) |
| (24S)-hydroxycholesterol 24-sulfate(1−) (CHEBI:136566) is conjugate base of (24S)-hydroxycholesterol 24-sulfate (CHEBI:137385) |
| IUPAC Name |
|---|
| (3β,24S)-3-hydroxycholest-5-en-24-yl hydrogen sulfate |
| Synonym | Source |
|---|---|
| 24-OHChol-24-sulfate | ChEBI |
| Citations |
|---|