EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28821 - piperine
| Formula | C17H19NO3 |
| Net Charge | 0 |
| Average Mass | 285.343 |
| Monoisotopic Mass | 285.13649 |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ |
| InChIKey | MXXWOMGUGJBKIW-YPCIICBESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Piper betle (ncbitaxon:13217) | - | DOI (10.1016/S0031-9422(98)00208-8) | |
| Piper khasianum (ncbitaxon:405331) | - | DOI (10.1016/S0031-9422(98)00208-8) | |
| Piper nigrum (ncbitaxon:13216) | - | PubMed (10575373) |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperine (CHEBI:28821) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| piperine (CHEBI:28821) has role food component (CHEBI:78295) |
| piperine (CHEBI:28821) has role human blood serum metabolite (CHEBI:85234) |
| piperine (CHEBI:28821) has role NF-κB inhibitor (CHEBI:73240) |
| piperine (CHEBI:28821) has role plant metabolite (CHEBI:76924) |
| piperine (CHEBI:28821) is a N-acylpiperidine (CHEBI:48591) |
| piperine (CHEBI:28821) is a benzodioxoles (CHEBI:38298) |
| piperine (CHEBI:28821) is a piperidine alkaloid (CHEBI:26147) |
| piperine (CHEBI:28821) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]piperidine |
| Synonyms | Source |
|---|---|
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]piperidine | ChemIDplus |
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-2,4-pentadienoyl]piperidine | NIST Chemistry WebBook |
| 1-piperoylpiperidine | NIST Chemistry WebBook |
| 1-Piperoyl-piperidine | KEGG COMPOUND |
| (E,E)-1-piperoylpiperidine | ChemIDplus |
| N-[(E,E)-Piperoyl]piperidine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| piperine | UniProt |
| Citations |
|---|