EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC(C)CC(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | ROHFNLRQFUQHCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucine (CHEBI:25017) has part isobutyl group (CHEBI:30356) |
| leucine (CHEBI:25017) has role Daphnia magna metabolite (CHEBI:83056) |
| leucine (CHEBI:25017) is a branched-chain amino acid (CHEBI:22918) |
| leucine (CHEBI:25017) is a α-amino acid (CHEBI:33704) |
| leucine (CHEBI:25017) is conjugate acid of leucinate (CHEBI:32627) |
| leucine (CHEBI:25017) is conjugate base of leucinium (CHEBI:32628) |
| Incoming Relation(s) |
| 4-hydroxyleucine (CHEBI:144037) has functional parent leucine (CHEBI:25017) |
| 5,5,5-trifluoroleucine (CHEBI:78014) has functional parent leucine (CHEBI:25017) |
| α-Asp-Leu (CHEBI:68596) has functional parent leucine (CHEBI:25017) |
| β-Asp-Leu (CHEBI:68600) has functional parent leucine (CHEBI:25017) |
| γ-Glu-Leu (CHEBI:68433) has functional parent leucine (CHEBI:25017) |
| D-leucine (CHEBI:28225) is a leucine (CHEBI:25017) |
| L-leucine (CHEBI:15603) is a leucine (CHEBI:25017) |
| leucinium (CHEBI:32628) is conjugate acid of leucine (CHEBI:25017) |
| leucinate (CHEBI:32627) is conjugate base of leucine (CHEBI:25017) |
| leucine residue (CHEBI:32630) is substituent group from leucine (CHEBI:25017) |
| leucino group (CHEBI:32629) is substituent group from leucine (CHEBI:25017) |
| leucyl group (CHEBI:37904) is substituent group from leucine (CHEBI:25017) |
| IUPAC Name |
|---|
| leucine |
| Synonyms | Source |
|---|---|
| 2-amino-4-methylpentanoic acid | IUPAC |
| DL-Leucine | ChemIDplus |
| Hleu | IUPAC |
| L | ChEBI |
| Leu | ChEBI |
| Leucin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16439 | KEGG COMPOUND |
| Leucine | Wikipedia |
| LMFA01100048 | LIPID MAPS |
| Citations |
|---|