EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC(C)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | ROHFNLRQFUQHCH-RXMQYKEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (15375647) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-leucine (CHEBI:28225) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-leucine (CHEBI:28225) has role bacterial metabolite (CHEBI:76969) |
| D-leucine (CHEBI:28225) is a D-α-amino acid (CHEBI:16733) |
| D-leucine (CHEBI:28225) is a leucine (CHEBI:25017) |
| D-leucine (CHEBI:28225) is conjugate acid of D-leucinate (CHEBI:32623) |
| D-leucine (CHEBI:28225) is conjugate base of D-leucinium (CHEBI:32624) |
| D-leucine (CHEBI:28225) is enantiomer of L-leucine (CHEBI:15603) |
| D-leucine (CHEBI:28225) is tautomer of D-leucine zwitterion (CHEBI:143079) |
| Incoming Relation(s) |
| D-leucine derivative (CHEBI:84114) has functional parent D-leucine (CHEBI:28225) |
| D-leucinium (CHEBI:32624) is conjugate acid of D-leucine (CHEBI:28225) |
| D-leucinate (CHEBI:32623) is conjugate base of D-leucine (CHEBI:28225) |
| L-leucine (CHEBI:15603) is enantiomer of D-leucine (CHEBI:28225) |
| D-leucine residue (CHEBI:30005) is substituent group from D-leucine (CHEBI:28225) |
| D-leucino group (CHEBI:32626) is substituent group from D-leucine (CHEBI:28225) |
| D-leucyl group (CHEBI:32625) is substituent group from D-leucine (CHEBI:28225) |
| D-leucine zwitterion (CHEBI:143079) is tautomer of D-leucine (CHEBI:28225) |
| IUPAC Name |
|---|
| D-leucine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-4-methylpentanoic acid | IUPAC |
| D-2-Amino-4-methylvaleric acid | KEGG COMPOUND |
| DLE | PDBeChem |
| D-Leucine | KEGG COMPOUND |
| D-LEUCINE | PDBeChem |
| (R)-(−)-leucine | NIST Chemistry WebBook |
| Citations |
|---|