EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH5AsO2 |
| Net Charge | 0 |
| Average Mass | 123.971 |
| Monoisotopic Mass | 123.95055 |
| SMILES | C[As](O)O |
| InChI | InChI=1S/CH5AsO2/c1-2(3)4/h3-4H,1H3 |
| InChIKey | OXBIRPQQKCQWGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10698679) |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylarsonous acid (CHEBI:17826) has functional parent arsonous acid (CHEBI:29847) |
| methylarsonous acid (CHEBI:17826) has role carcinogenic agent (CHEBI:50903) |
| methylarsonous acid (CHEBI:17826) has role human xenobiotic metabolite (CHEBI:76967) |
| methylarsonous acid (CHEBI:17826) has role poison (CHEBI:64909) |
| methylarsonous acid (CHEBI:17826) is a arsonous acids (CHEBI:50017) |
| methylarsonous acid (CHEBI:17826) is a one-carbon compound (CHEBI:64708) |
| methylarsonous acid (CHEBI:17826) is conjugate acid of methylarsonite (CHEBI:14597) |
| Incoming Relation(s) |
| methylarsonite (CHEBI:14597) is conjugate base of methylarsonous acid (CHEBI:17826) |
| IUPAC Name |
|---|
| methylarsonous acid |
| Synonyms | Source |
|---|---|
| MeAs(OH)2 | ChEBI |
| Methanearsonous acid | ChemIDplus |
| Methylarsonite | ChEBI |
| Methylarsonous acid | HMDB |
| Mma(III) | HMDB |
| MMAIII | ChEBI |
| UniProt Name | Source |
|---|---|
| methylarsonous acid | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 6OL | PDBeChem |
| C07295 | KEGG COMPOUND |
| c0772 | UM-BBD |
| FDB028898 | FooDB |
| HMDB0012259 | HMDB |
| METHYLARSONITE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2231128 | Reaxys |
| CAS:25400-23-1 | ChemIDplus |
| Citations |
|---|