EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH5AsO2 |
| Net Charge | 0 |
| Average Mass | 123.971 |
| Monoisotopic Mass | 123.95055 |
| SMILES | C[As](O)O |
| InChI | InChI=1S/CH5AsO2/c1-2(3)4/h3-4H,1H3 |
| InChIKey | OXBIRPQQKCQWGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10698679) |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylarsonous acid (CHEBI:17826) has functional parent arsonous acid (CHEBI:29847) |
| methylarsonous acid (CHEBI:17826) has role carcinogenic agent (CHEBI:50903) |
| methylarsonous acid (CHEBI:17826) has role human xenobiotic metabolite (CHEBI:76967) |
| methylarsonous acid (CHEBI:17826) has role poison (CHEBI:64909) |
| methylarsonous acid (CHEBI:17826) is a arsonous acids (CHEBI:50017) |
| methylarsonous acid (CHEBI:17826) is a one-carbon compound (CHEBI:64708) |
| methylarsonous acid (CHEBI:17826) is conjugate acid of methylarsonite (CHEBI:14597) |
| Incoming Relation(s) |
| methylarsonite (CHEBI:14597) is conjugate base of methylarsonous acid (CHEBI:17826) |
| IUPAC Name |
|---|
| methylarsonous acid |
| Synonyms | Source |
|---|---|
| MeAs(OH)2 | ChEBI |
| Methanearsonous acid | ChemIDplus |
| Methylarsonite | ChEBI |
| Methylarsonous acid | HMDB |
| Mma(III) | HMDB |
| MMAIII | ChEBI |
| UniProt Name | Source |
|---|---|
| methylarsonous acid | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 6OL | PDBeChem |
| C07295 | KEGG COMPOUND |
| c0772 | UM-BBD |
| FDB028898 | FooDB |
| HMDB0012259 | HMDB |
| METHYLARSONITE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2231128 | Reaxys |
| CAS:25400-23-1 | ChemIDplus |
| Citations |
|---|