EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH3AsO2 |
| Net Charge | -2 |
| Average Mass | 121.955 |
| Monoisotopic Mass | 121.93600 |
| SMILES | C[As]([O-])[O-] |
| InChI | InChI=1S/CH3AsO2/c1-2(3)4/h1H3/q-2 |
| InChIKey | OMPSDEOAXJHSLH-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylarsonite (CHEBI:14597) has functional parent arsonite(2−) (CHEBI:29753) |
| methylarsonite (CHEBI:14597) is a arsenic oxoanion (CHEBI:35776) |
| methylarsonite (CHEBI:14597) is conjugate base of methylarsonous acid (CHEBI:17826) |
| Incoming Relation(s) |
| methylarsonous acid (CHEBI:17826) is conjugate acid of methylarsonite (CHEBI:14597) |
| IUPAC Name |
|---|
| methylarsonite |
| Synonym | Source |
|---|---|
| [As(CH3)O2]2− | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11246400 | Reaxys |