EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-18,21-26,28-29H,1H3/t7-,15-,17+,18+,21-/m0/s1 |
| InChIKey | OXGUCUVFOIWWQJ-HQBVPOQASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthopanax senticosus (ncbitaxon:82096) | leaf (BTO:0000713) | PubMed (11816040) | |
| Malpighia emarginata (ncbitaxon:151847) | fruit (BTO:0000486) | PubMed (15725651) | |
| Melastoma candidum (ncbitaxon:119954) | leaf (BTO:0000713) | PubMed (11714358) | |
| Rhododendron yedoense var. poukhanense (ncbitaxon:224354) | flower (BTO:0000469) | PubMed (17366733) | |
| Zanthoxylum piperitum (ncbitaxon:354529) | leaf (BTO:0000713) | PubMed (15388977) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of carbonyl reductase (NADPH), EC 1.1.1.184. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercitrin (CHEBI:17558) has role antileishmanial agent (CHEBI:70868) |
| quercitrin (CHEBI:17558) has role antioxidant (CHEBI:22586) |
| quercitrin (CHEBI:17558) has role EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor (CHEBI:73136) |
| quercitrin (CHEBI:17558) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| quercitrin (CHEBI:17558) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| quercitrin (CHEBI:17558) has role plant metabolite (CHEBI:76924) |
| quercitrin (CHEBI:17558) is a monosaccharide derivative (CHEBI:63367) |
| quercitrin (CHEBI:17558) is a quercetin O-glycoside (CHEBI:76424) |
| quercitrin (CHEBI:17558) is a tetrahydroxyflavone (CHEBI:38684) |
| quercitrin (CHEBI:17558) is a α-L-rhamnoside (CHEBI:27848) |
| quercitrin (CHEBI:17558) is conjugate acid of quercitrin-7-olate (CHEBI:58192) |
| Incoming Relation(s) |
| quercitrin-7-olate (CHEBI:58192) is conjugate base of quercitrin (CHEBI:17558) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| 3,3',4',5,7-Pentahydroxyflavone-3-L-rhamnoside | ChemIDplus |
| 3-((6-Deoxy-alpha-L-mannopyranosyl)-oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| luteolin 6-deoxy-α-L-mannopyranoside | ChEBI |
| Quercetin 3-O-rhamnoside | ChEBI |
| quercetin 3-O-α-L-rhamnopyranoside | ChEBI |
| quercetin-3-L-rhamnoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00005374 | KNApSAcK |
| C01750 | KEGG COMPOUND |
| HMDB0033751 | HMDB |
| LMPK12112171 | LIPID MAPS |
| Quercitrin | Wikipedia |
| QUERCITRIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:68135 | Reaxys |
| CAS:522-12-3 | KEGG COMPOUND |
| CAS:522-12-3 | ChemIDplus |
| Citations |
|---|