EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35N3O7 |
| Net Charge | 0 |
| Average Mass | 525.602 |
| Monoisotopic Mass | 525.24750 |
| SMILES | CC1=C\[C@@H](O)CC(=O)Cc2nc(co2)C(=O)N2CCC=C2C(=O)O[C@H](C(C)C)[C@H](C)/C=C/C(=O)NC\C=C\1 |
| InChI | InChI=1S/C28H35N3O7/c1-17(2)26-19(4)9-10-24(34)29-11-5-7-18(3)13-20(32)14-21(33)15-25-30-22(16-37-25)27(35)31-12-6-8-23(31)28(36)38-26/h5,7-10,13,16-17,19-20,26,32H,6,11-12,14-15H2,1-4H3,(H,29,34)/b7-5+,10-9+,18-13+/t19-,20-,26-/m1/s1 |
| InChIKey | DAIKHDNSXMZDCU-FQTGFAPKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) | |
| Streptomyces pristinaespiralis (ncbitaxon:38300) | - | PubMed (25708513) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pristinamycin IIA (CHEBI:9997) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| pristinamycin IIA (CHEBI:9997) has role antibacterial drug (CHEBI:36047) |
| pristinamycin IIA (CHEBI:9997) is a 1,3-oxazoles (CHEBI:46812) |
| pristinamycin IIA (CHEBI:9997) is a cyclic ketone (CHEBI:3992) |
| pristinamycin IIA (CHEBI:9997) is a enamide (CHEBI:51751) |
| pristinamycin IIA (CHEBI:9997) is a lactam (CHEBI:24995) |
| pristinamycin IIA (CHEBI:9997) is a macrolide (CHEBI:25106) |
| pristinamycin IIA (CHEBI:9997) is a macrolide antibiotic (CHEBI:25105) |
| pristinamycin IIA (CHEBI:9997) is a pyrroline (CHEBI:23763) |
| pristinamycin IIA (CHEBI:9997) is a secondary alcohol (CHEBI:35681) |
| pristinamycin IIA (CHEBI:9997) is a secondary carboxamide (CHEBI:140325) |
| pristinamycin IIA (CHEBI:9997) is a tertiary carboxamide (CHEBI:140326) |
| Incoming Relation(s) |
| dalfopristin (CHEBI:4309) has functional parent pristinamycin IIA (CHEBI:9997) |
| virginiamycin (CHEBI:87209) has part pristinamycin IIA (CHEBI:9997) |
| IUPAC Name |
|---|
| (3R,4R,5E,10E,12E,14S)-14-hydroxy-3-isopropyl-4,12-dimethyl-8,9,14,15,24,25-hexahydro-1H,3H,22H-21,18-(azeno)pyrrolo[2,1-c][1,8,4,19]dioxadiazacyclotetracosine-1,7,16,22(4H,17H)-tetrone |
| Synonyms | Source |
|---|---|
| Virginiamycin M1 | KEGG COMPOUND |
| Mikamycin A | KEGG COMPOUND |
| Streptogramin A | KEGG COMPOUND |
| Ostreogrycin a | ChemIDplus |
| Virginiamycin factor M1 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11299 | KEGG COMPOUND |
| VIR | PDBeChem |
| Pristinamycin_IIA | Wikipedia |
| DB01669 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71867 | Reaxys |
| CAS:21411-53-0 | KEGG COMPOUND |
| CAS:21411-53-0 | ChemIDplus |
| Citations |
|---|