EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H50N4O9S |
| Net Charge | 0 |
| Average Mass | 690.860 |
| Monoisotopic Mass | 690.32985 |
| SMILES | [H][C@@]12C(=O)O[C@H](C(C)C)[C@H](C)/C=C/C(=O)NC/C=C/C(C)=C/[C@@H](O)CC(=O)Cc3nc(co3)C(=O)N1CC[C@H]2S(=O)(=O)CCN(CC)CC |
| InChI | InChI=1S/C34H50N4O9S/c1-7-37(8-2)16-17-48(44,45)28-13-15-38-31(28)34(43)47-32(22(3)4)24(6)11-12-29(41)35-14-9-10-23(5)18-25(39)19-26(40)20-30-36-27(21-46-30)33(38)42/h9-12,18,21-22,24-25,28,31-32,39H,7-8,13-17,19-20H2,1-6H3,(H,35,41)/b10-9+,12-11+,23-18+/t24-,25-,28-,31-,32-/m1/s1 |
| InChIKey | SUYRLXYYZQTJHF-VMBLUXKRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dalfopristin (CHEBI:4309) has functional parent pristinamycin IIA (CHEBI:9997) |
| dalfopristin (CHEBI:4309) has role antibacterial drug (CHEBI:36047) |
| dalfopristin (CHEBI:4309) has role protein synthesis inhibitor (CHEBI:48001) |
| dalfopristin (CHEBI:4309) is a 1,3-oxazoles (CHEBI:46812) |
| dalfopristin (CHEBI:4309) is a carboxylic ester (CHEBI:33308) |
| dalfopristin (CHEBI:4309) is a cyclic ketone (CHEBI:3992) |
| dalfopristin (CHEBI:4309) is a enamide (CHEBI:51751) |
| dalfopristin (CHEBI:4309) is a macrolide (CHEBI:25106) |
| dalfopristin (CHEBI:4309) is a macrolide antibiotic (CHEBI:25105) |
| dalfopristin (CHEBI:4309) is a secondary alcohol (CHEBI:35681) |
| dalfopristin (CHEBI:4309) is a secondary carboxamide (CHEBI:140325) |
| dalfopristin (CHEBI:4309) is a sulfone (CHEBI:35850) |
| dalfopristin (CHEBI:4309) is a tertiary amino compound (CHEBI:50996) |
| dalfopristin (CHEBI:4309) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (3R,4R,5E,10E,12E,14S,26R,26aS)-26-{[2-(diethylamino)ethyl]sulfonyl}-14-hydroxy-4,12-dimethyl-3-(propan-2-yl)-8,9,14,15,24,25,26,26a-octahydro-1H,3H,22H-21,18-(azeno)pyrrolo[2,1-c][1,8,4,19]dioxadiazacyclotetracosine-1,7,16,22(4H,17H)-tetrone |
| INNs | Source |
|---|---|
| dalfopristin | WHO MedNet |
| dalfopristina | WHO MedNet |
| dalfopristine | WHO MedNet |
| dalfopristinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| RP 54476 | ChemIDplus |
| RP-54476 | DrugCentral |
| RP54476 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 778 | DrugCentral |
| C08033 | KEGG COMPOUND |
| D00853 | KEGG DRUG |
| Dalfopristin | Wikipedia |
| DB01764 | DrugBank |
| DOL | PDBeChem |
| HMDB0015566 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:112362-50-2 | ChemIDplus |
| Citations |
|---|