EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9985 - vincamine
| Formula | C21H26N2O3 |
| Net Charge | 0 |
| Average Mass | 354.450 |
| Monoisotopic Mass | 354.19434 |
| SMILES | [H][C@@]12c3c4c5ccccc5n3[C@@](O)(C(=O)OC)C[C@]1(CC)CCCN2CC4 |
| InChI | InChI=1S/C21H26N2O3/c1-3-20-10-6-11-22-12-9-15-14-7-4-5-8-16(14)23(17(15)18(20)22)21(25,13-20)19(24)26-2/h4-5,7-8,18,25H,3,6,9-13H2,1-2H3/t18-,20+,21+/m1/s1 |
| InChIKey | RXPRRQLKFXBCSJ-GIVPXCGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alstonia spatulata (IPNI:76595-1) | leaf (BTO:0000713) | PubMed (21043460) | Extraction of leaves with concentrated EtOH with dilute acids |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vincamine (CHEBI:9985) has functional parent eburnamenine (CHEBI:35644) |
| vincamine (CHEBI:9985) has role antihypertensive agent (CHEBI:35674) |
| vincamine (CHEBI:9985) has role metabolite (CHEBI:25212) |
| vincamine (CHEBI:9985) has role vasodilator agent (CHEBI:35620) |
| vincamine (CHEBI:9985) is a alkaloid ester (CHEBI:38481) |
| vincamine (CHEBI:9985) is a hemiaminal (CHEBI:73080) |
| vincamine (CHEBI:9985) is a methyl ester (CHEBI:25248) |
| vincamine (CHEBI:9985) is a organic heteropentacyclic compound (CHEBI:38164) |
| vincamine (CHEBI:9985) is a vinca alkaloid (CHEBI:27288) |
| IUPAC Name |
|---|
| methyl 14β-hydroxy-14,15-dihydro-3α,16α-eburnamenine-14α-carboxylate |
| Synonyms | Source |
|---|---|
| Vincamine | KEGG COMPOUND |
| (+)-Vincamine | ChemIDplus |
| Methyl vincaminate | ChemIDplus |
| Pervincamine | ChemIDplus |
| Vincamidol | ChemIDplus |