EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2 |
| Net Charge | 0 |
| Average Mass | 278.399 |
| Monoisotopic Mass | 278.17830 |
| SMILES | [H][C@]12c3c4c5ccccc5n3C=C[C@@]1(CC)CCCN2CC4 |
| InChI | InChI=1S/C19H22N2/c1-2-19-9-5-11-20-12-8-15-14-6-3-4-7-16(14)21(13-10-19)17(15)18(19)20/h3-4,6-7,10,13,18H,2,5,8-9,11-12H2,1H3/t18-,19+/m0/s1 |
| InChIKey | VKTOXAGUZWAECL-RBUKOAKNSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eburnamenine (CHEBI:35644) is a indole alkaloid (CHEBI:38958) |
| eburnamenine (CHEBI:35644) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| vincamine (CHEBI:9985) has functional parent eburnamenine (CHEBI:35644) |
| IUPAC Name |
|---|
| eburnamenine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:34697 | Beilstein |