EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O4.H2O |
| Net Charge | 0 |
| Average Mass | 285.260 |
| Monoisotopic Mass | 285.10732 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O.O |
| InChI | InChI=1S/C10H13N5O4.H2O/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);1H2/t4-,6-,7+,10-;/m1./s1 |
| InChIKey | ZTHWFVSEMLMLKT-CAMOTBBTSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vidarabine monohydrate (CHEBI:9978) is a adenine arabinoside (CHEBI:45327) |
| Synonym | Source |
|---|---|
| 9-beta-D-Arabino furanosyl adenine monohydrate | KEGG COMPOUND |