EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O4 |
| Net Charge | 0 |
| Average Mass | 267.245 |
| Monoisotopic Mass | 267.09675 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7+,10-/m1/s1 |
| InChIKey | OIRDTQYFTABQOQ-UHTZMRCNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adenine arabinoside (CHEBI:45327) has functional parent adenine (CHEBI:16708) |
| adenine arabinoside (CHEBI:45327) has role antineoplastic agent (CHEBI:35610) |
| adenine arabinoside (CHEBI:45327) has role antiviral agent (CHEBI:22587) |
| adenine arabinoside (CHEBI:45327) has role bacterial metabolite (CHEBI:76969) |
| adenine arabinoside (CHEBI:45327) has role nucleoside antibiotic (CHEBI:25605) |
| adenine arabinoside (CHEBI:45327) has role ophthalmology drug (CHEBI:66981) |
| adenine arabinoside (CHEBI:45327) is a purine nucleoside (CHEBI:26394) |
| adenine arabinoside (CHEBI:45327) is a β-D-arabinoside (CHEBI:38315) |
| Incoming Relation(s) |
| vidarabine monohydrate (CHEBI:9978) is a adenine arabinoside (CHEBI:45327) |
| IUPAC Names |
|---|
| 9H-adenin-9-yl β-D-arabinofuranoside |
| 9-(β-D-arabinofuranosyl)-9H-adenine |
| INN | Source |
|---|---|
| vidarabina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(6-AMINO-PURIN-9-YL)-5-HYDROXYMETHYL-TETRAHYDRO-FURAN-3,4-DIOL | PDBeChem |
| 9-beta-D-Arabinofuranosyladenine | ChemIDplus |
| 9-β-D-arabinofuranosyl-9H-purin-6-amine | IUPAC |
| ARA-A | ChEMBL |
| Arasena-a | ChEMBL |
| CI 673 | ChEMBL |
| Brand Name | Source |
|---|---|
| Vira-a | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2818 | DrugCentral |
| DB00194 | DrugBank |
| HMDB0014340 | HMDB |
| LSM-5800 | LINCS |
| RAB | PDBeChem |
| Vidarabine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:624881 | Beilstein |
| Reaxys:624881 | Reaxys |
| CAS:5536-17-4 | ChemIDplus |
| Citations |
|---|