EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | [H][C@]1(c2ccc(OC)cc2O)COc2cc(O)ccc2C1 |
| InChI | InChI=1S/C16H16O4/c1-19-13-4-5-14(15(18)8-13)11-6-10-2-3-12(17)7-16(10)20-9-11/h2-5,7-8,11,17-18H,6,9H2,1H3/t11-/m1/s1 |
| InChIKey | XRVFNNUXNVWYTI-LLVKDONJSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-vestitol (CHEBI:9971) has role plant metabolite (CHEBI:76924) |
| (+)-vestitol (CHEBI:9971) is a vestitol (CHEBI:69088) |
| IUPAC Name |
|---|
| (3S)-3-(2-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| Synonym | Source |
|---|---|
| (3S)-vestitol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C10540 | KEGG COMPOUND |
| LMPK12080026 | LIPID MAPS |
| C00002583 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5093419 | Reaxys |
| CAS:20879-05-4 | KEGG COMPOUND |
| CAS:20879-05-4 | ChemIDplus |