EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | COc1ccc(C2COc3cc(O)ccc3C2)c(O)c1 |
| InChI | InChI=1S/C16H16O4/c1-19-13-4-5-14(15(18)8-13)11-6-10-2-3-12(17)7-16(10)20-9-11/h2-5,7-8,11,17-18H,6,9H2,1H3 |
| InChIKey | XRVFNNUXNVWYTI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vestitol (CHEBI:69088) has role anti-inflammatory agent (CHEBI:67079) |
| vestitol (CHEBI:69088) has role phytoalexin (CHEBI:26115) |
| vestitol (CHEBI:69088) has role plant metabolite (CHEBI:76924) |
| vestitol (CHEBI:69088) is a aromatic ether (CHEBI:35618) |
| vestitol (CHEBI:69088) is a hydroxyisoflavans (CHEBI:76250) |
| vestitol (CHEBI:69088) is a methoxyisoflavan (CHEBI:77002) |
| Incoming Relation(s) |
| (+)-vestitol (CHEBI:9971) is a vestitol (CHEBI:69088) |
| IUPAC Name |
|---|
| 3-(2-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1393626 | Reaxys |
| CAS:56701-24-7 | ChemIDplus |
| Citations |
|---|