EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | DCSCXTJOXBUFGB-SFYZADRCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-(+)-verbenone (CHEBI:9955) has role plant metabolite (CHEBI:76924) |
| (R)-(+)-verbenone (CHEBI:9955) is a 4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one (CHEBI:78315) |
| (R)-(+)-verbenone (CHEBI:9955) is a terpenoid (CHEBI:26873) |
| (R)-(+)-verbenone (CHEBI:9955) is enantiomer of (S)-(−)-verbenone (CHEBI:78316) |
| Incoming Relation(s) |
| (S)-(−)-verbenone (CHEBI:78316) is enantiomer of (R)-(+)-verbenone (CHEBI:9955) |
| IUPAC Name |
|---|
| (1R,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one |
| Synonyms | Source |
|---|---|
| (1R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one | NIST Chemistry WebBook |
| (1R,5R)-(+)-2-pinen-4-one | ChEBI |
| (1R,5R)-2-pinen-4-one | ChEBI |
| (1R,5R)-(+)-pin-2-en-4-one | ChEBI |
| (1R,5R)-pin-2-en-4-one | ChEBI |
| (1R-cis)-4,6,6-trimethylbicyclo(3.1.1)hept-3-en-2-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2042766 | Reaxys |
| CAS:18309-32-5 | KEGG COMPOUND |
| CAS:18309-32-5 | ChemIDplus |
| CAS:18309-32-5 | NIST Chemistry WebBook |
| Citations |
|---|