EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | CC1=CC(=O)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | DCSCXTJOXBUFGB-JGVFFNPUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | expectorant Compounds that are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. Compare with mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration, and antitussives, which suppress the cough reflex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(−)-verbenone (CHEBI:78316) has role expectorant (CHEBI:77035) |
| (S)-(−)-verbenone (CHEBI:78316) is a 4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one (CHEBI:78315) |
| (S)-(−)-verbenone (CHEBI:78316) is enantiomer of (R)-(+)-verbenone (CHEBI:9955) |
| Incoming Relation(s) |
| (R)-(+)-verbenone (CHEBI:9955) is enantiomer of (S)-(−)-verbenone (CHEBI:78316) |
| IUPAC Name |
|---|
| (1S,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one |
| Synonyms | Source |
|---|---|
| l-verbenoe | ChemIDplus |
| levoverbenone | ChEBI |
| (−)-verbenone | ChemIDplus |
| (−)-cis-verbenone | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Levoverbenone | Wikipedia |
| 4587 | DrugCentral |
| Citations |
|---|