EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO2 |
| Net Charge | 0 |
| Average Mass | 409.614 |
| Monoisotopic Mass | 409.29808 |
| SMILES | [H][C@@]1([C@@H](C)c2ccc3c(c2C)C[C@]2([H])[C@@]4(C)CC[C@H](O)CC4=CC[C@@]32[H])NC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C27H39NO2/c1-15-11-25(30)26(28-14-15)17(3)20-7-8-21-22-6-5-18-12-19(29)9-10-27(18,4)24(22)13-23(21)16(20)2/h5,7-8,15,17,19,22,24-26,28-30H,6,9-14H2,1-4H3/t15-,17-,19-,22-,24-,25+,26-,27-/m0/s1 |
| InChIKey | MALFODICFSIXPO-KFKQDBFTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| veratramine (CHEBI:9951) has parent hydride veratraman (CHEBI:36374) |
| veratramine (CHEBI:9951) is a piperidine alkaloid (CHEBI:26147) |
| IUPAC Name |
|---|
| (3β,23R)-14,15,16,17-tetradehydroveratraman-3,23-diol |
| Synonyms | Source |
|---|---|
| (3β,23β)-14,15,16,17-tetradehydroveratraman-3,23-diol | ChemIDplus |
| Veratramine | KEGG COMPOUND |