EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43N |
| Net Charge | 0 |
| Average Mass | 381.648 |
| Monoisotopic Mass | 381.33955 |
| SMILES | [H][C@]12CC3=C(C)[C@]([H])([C@H](C)[C@@]4([H])CC[C@H](C)CN4)CC[C@@]3([H])[C@]1([H])CC=C1CCCC[C@@]12C |
| InChI | InChI=1S/C27H43N/c1-17-8-13-26(28-16-17)19(3)21-11-12-22-23-10-9-20-7-5-6-14-27(20,4)25(23)15-24(22)18(21)2/h9,17,19,21-23,25-26,28H,5-8,10-16H2,1-4H3/t17-,19-,21+,22-,23-,25-,26+,27-/m0/s1 |
| InChIKey | INQCTYQIXKBOAE-HVZOBAMXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| veratraman (CHEBI:36374) is a piperidine alkaloid (CHEBI:26147) |
| veratraman (CHEBI:36374) is a piperidine alkaloid fundamental parent (CHEBI:38529) |
| Incoming Relation(s) |
| veratramine (CHEBI:9951) has parent hydride veratraman (CHEBI:36374) |
| IUPAC Name |
|---|
| veratraman |