EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C34H57N2O4 |
| Net Charge | 0 |
| Average Mass | 637.744 |
| Monoisotopic Mass | 636.35017 |
| SMILES | [Br-].[H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OC(C)=O)[C@@H]([N+]5(C)CCCCC5)C[C@@]34[H])[C@@]1(C)C[C@H](N1CCCCC1)[C@@H](OC(C)=O)C2 |
| InChI | InChI=1S/C34H57N2O4.BrH/c1-23(37)39-31-20-25-12-13-26-27(34(25,4)22-29(31)35-16-8-6-9-17-35)14-15-33(3)28(26)21-30(32(33)40-24(2)38)36(5)18-10-7-11-19-36;/h25-32H,6-22H2,1-5H3;1H/q+1;/p-1/t25-,26+,27-,28-,29-,30-,31-,32-,33-,34-;/m0./s1 |
| InChIKey | VEPSYABRBFXYIB-PWXDFCLTSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Applications: | neuromuscular agent A drug used for its actions on skeletal muscle. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vecuronium bromide (CHEBI:9940) has functional parent 5α-androstane (CHEBI:28859) |
| vecuronium bromide (CHEBI:9940) has part vecuronium (CHEBI:9939) |
| vecuronium bromide (CHEBI:9940) has role muscle relaxant (CHEBI:51371) |
| vecuronium bromide (CHEBI:9940) has role neuromuscular agent (CHEBI:51372) |
| vecuronium bromide (CHEBI:9940) has role nicotinic antagonist (CHEBI:48878) |
| vecuronium bromide (CHEBI:9940) is a organic bromide salt (CHEBI:48369) |
| vecuronium bromide (CHEBI:9940) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (2β,3α,5α,16β,17β)-3,17-diacetoxy-16-(1-methylpiperidinium-1-yl)-2-(piperidin-1-yl)androstane bromide |
| INNs | Source |
|---|---|
| bromure de vecuronium | ChemIDplus |
| bromuro de vecuronio | ChemIDplus |
| vecuronii bromidum | ChemIDplus |
| vecuronium bromide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1-(3alpha,17beta-Dihydroxy-2beta-piperidino-5alpha-androstan-16beta,5alpha-yl)-1-methylpiperidinium bromide, diacetate | ChemIDplus |
| 1-[3α,17β-bis(acetoxy)-2β-(1-piperidinyl)-5α-androstan-16β-yl]-1-methylpiperidinium bromide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101843593 | Patent |
| D00767 | KEGG DRUG |
| DB01339 | DrugBank |
| Vecuronium_bromide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7164568 | Reaxys |
| CAS:50700-72-6 | KEGG DRUG |
| CAS:50700-72-6 | DrugBank |
| CAS:50700-72-6 | ChemIDplus |
| Citations |
|---|