EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N3O3 |
| Net Charge | 0 |
| Average Mass | 475.633 |
| Monoisotopic Mass | 475.28349 |
| SMILES | [H][C@]1(C[C@@]2([H])NCCc3c2nc2ccc(O)cc32)C[C@@]2([H])c3cc(OC)c(OC)cc3CCN2C[C@@H]1CC |
| InChI | InChI=1S/C29H37N3O3/c1-4-17-16-32-10-8-18-13-27(34-2)28(35-3)15-22(18)26(32)12-19(17)11-25-29-21(7-9-30-25)23-14-20(33)5-6-24(23)31-29/h5-6,13-15,17,19,25-26,30-31,33H,4,7-12,16H2,1-3H3/t17-,19-,25+,26-/m0/s1 |
| InChIKey | JRVWIILYWSBUMC-PRUVNFMMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tubulosine (CHEBI:9775) has parent hydride tubulosan (CHEBI:36379) |
| tubulosine (CHEBI:9775) is a isoquinoline alkaloid (CHEBI:24921) |
| tubulosine (CHEBI:9775) is a isoquinolines (CHEBI:24922) |
| tubulosine (CHEBI:9775) is a phenols (CHEBI:33853) |
| tubulosine (CHEBI:9775) is a secondary amino compound (CHEBI:50995) |
| tubulosine (CHEBI:9775) is a tertiary amino compound (CHEBI:50996) |
| tubulosine (CHEBI:9775) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| 10,11-dimethoxytubulosan-8'-ol |
| Synonym | Source |
|---|---|
| Tubulosine | KEGG COMPOUND |
| Citations |
|---|