EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N3 |
| Net Charge | 0 |
| Average Mass | 399.582 |
| Monoisotopic Mass | 399.26745 |
| SMILES | [H][C@]1(C[C@@]2([H])NCCc3c2nc2ccccc32)C[C@@]2([H])c3ccccc3CCN2C[C@@H]1CC |
| InChI | InChI=1S/C27H33N3/c1-2-18-17-30-14-12-19-7-3-4-8-21(19)26(30)16-20(18)15-25-27-23(11-13-28-25)22-9-5-6-10-24(22)29-27/h3-10,18,20,25-26,28-29H,2,11-17H2,1H3/t18-,20-,25+,26-/m0/s1 |
| InChIKey | AIZBUQBFRLEIBW-LXFCCGDJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tubulosan (CHEBI:36379) is a indole alkaloid (CHEBI:38958) |
| tubulosan (CHEBI:36379) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| alangimarckine (CHEBI:2536) has functional parent tubulosan (CHEBI:36379) |
| tubulosine (CHEBI:9775) has parent hydride tubulosan (CHEBI:36379) |
| IUPAC Name |
|---|
| tubulosan |