EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O11 |
| Net Charge | 0 |
| Average Mass | 422.342 |
| Monoisotopic Mass | 422.08491 |
| SMILES | O=c1c2cc(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C19H18O11/c20-5-13-16(25)17(26)18(27)19(30-13)29-11-4-10-7(3-8(11)22)15(24)14-9(23)1-6(21)2-12(14)28-10/h1-4,13,16-23,25-27H,5H2/t13-,16-,17+,18-,19-/m1/s1 |
| InChIKey | DSJIWZUDANJKCU-LQDZTQBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterospermum taiwanense (ncbitaxon:933385) | - | Article (Encyclopedia of Traditional Chinese Medicines) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tripteroside (CHEBI:9746) has functional parent norathyriol (CHEBI:7622) |
| tripteroside (CHEBI:9746) has role plant metabolite (CHEBI:76924) |
| tripteroside (CHEBI:9746) is a monosaccharide derivative (CHEBI:63367) |
| tripteroside (CHEBI:9746) is a polyphenol (CHEBI:26195) |
| tripteroside (CHEBI:9746) is a xanthone glycoside (CHEBI:83231) |
| tripteroside (CHEBI:9746) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2,6,8-trihydroxy-9-oxo-9H-xanthen-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Norathyriol-6-O-beta-D-glucoside | KEGG COMPOUND |