EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7622 - norathyriol
| Formula | C13H8O6 |
| Net Charge | 0 |
| Average Mass | 260.201 |
| Monoisotopic Mass | 260.03209 |
| SMILES | O=c1c2cc(O)c(O)cc2oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C13H8O6/c14-5-1-9(17)12-11(2-5)19-10-4-8(16)7(15)3-6(10)13(12)18/h1-4,14-17H |
| InChIKey | ZHTQCPCDXKMMLU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allanblackia floribunda (ncbitaxon:469914) | - | DOI (10.1039/J39710001332) | |
| Anaxagorea luzonensis (ncbitaxon:235716) | - | Article (NATURAL MEDICINES,2001,55,316) | |
| Athyrium mesosorum (IPNI:17055670-1) | - | PubMed (13995190) | |
| Canscora decussata (IPNI:366549-1) | - | DOI (10.1016/S0031-9422(00)91530-9) | |
| Chlorophora tinctoria (IPNI:1131012-2) | - | DOI (10.1016/0031-9422(75)85393-3) | |
| Cratoxylum pruniflorum (IPNI:433071-1) | - | Article (PHARMAZIE,1988,43,879) | |
| Garcinia echinocarpa (IPNI:427934-1) | - | DOI (10.1016/0031-9422(75)85322-2) | |
| Garcinia mangostana (ncbitaxon:58228) | - | DOI (10.1016/0031-9422(75)80385-2) | |
| Garcinia multiflora (ncbitaxon:1009474) | - | DOI (10.1016/0031-9422(75)85069-2) | |
| Garcinia pedunculata (IPNI:428166-1) | - | DOI (10.1016/0031-9422(74)80109-3) | |
| Garcinia terpnophylla (IPNI:428266-1) | - | DOI (10.1016/0031-9422(75)85322-2) | |
| Gymnocarpium robertianum (ncbitaxon:983334) | - | Article (YAKUGAKU ZASSHI,1986,106,378) | |
| Hypericum androsaemum (ncbitaxon:140968) | - | DOI (10.1021/np50003a012) | |
| Hypericum aucheri (IPNI:433222-1) | - | Article (KHIMIYA PRIRODNYKH SOEDINENII,1980,2,256) | |
| Hypericum japonicum (ncbitaxon:282542) | - | Article (NAT PROD RES DEV,2004,16,511) | |
| Hypericum sampsonii (ncbitaxon:282553) | - | PubMed (15256712) | |
| Iris nigricans (ncbitaxon:995810) | - | DOI (10.1016/0031-9422(94)00641-6) | |
| Maclura pomifera (ncbitaxon:3496) | - | DOI (10.1016/S0031-9422(00)86247-0) | |
| Mammea africana (ncbitaxon:999584) | - | DOI (10.1016/S0031-9422(00)88089-9) | |
| Morus tinctoria (IPNI:164496-2) | - | DOI (10.1038/2071193a0) | |
| Ochrocarpos (ncbitaxon:469946) | - | DOI (10.1016/S0031-9422(00)97372-2) | |
| Pentaphalangium (ncbitaxon:58227) | - | DOI (10.1039/P19740001018) | |
| Symphonia globulifera (ncbitaxon:156483) | - | DOI (10.1016/0040-4020(67)80058-9) | |
| Tripterospermum lanceolatum (ncbitaxon:933376) | - | PubMed (9384257) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norathyriol (CHEBI:7622) has role antineoplastic agent (CHEBI:35610) |
| norathyriol (CHEBI:7622) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| norathyriol (CHEBI:7622) has role plant metabolite (CHEBI:76924) |
| norathyriol (CHEBI:7622) is a polyphenol (CHEBI:26195) |
| norathyriol (CHEBI:7622) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| tripteroside (CHEBI:9746) has functional parent norathyriol (CHEBI:7622) |
| IUPAC Name |
|---|
| 1,3,6,7-tetrahydroxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 1,3,6,7-tetrahydroxyxanthone | ChEBI |
| 1,3,6,7-Tetrahydroxyxanthone | KEGG COMPOUND |
| Norathyriol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002968 | KNApSAcK |
| C10086 | KEGG COMPOUND |
| CN102657640 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:270886 | Reaxys |
| CAS:3542-72-1 | ChemIDplus |
| CAS:3542-72-1 | KEGG COMPOUND |
| Citations |
|---|