EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27FO6 |
| Net Charge | 0 |
| Average Mass | 394.439 |
| Monoisotopic Mass | 394.17917 |
| SMILES | [H][C@@]12C[C@@H](O)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C21H27FO6/c1-18-6-5-12(24)7-11(18)3-4-13-14-8-15(25)21(28,17(27)10-23)19(14,2)9-16(26)20(13,18)22/h5-7,13-16,23,25-26,28H,3-4,8-10H2,1-2H3/t13-,14-,15+,16-,18-,19-,20-,21-/m0/s1 |
| InChIKey | GFNANZIMVAIWHM-OBYCQNJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory drug A substance that reduces or suppresses inflammation. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. antipsoriatic A drug used to treat psoriasis. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triamcinolone (CHEBI:9667) has parent hydride pregnane (CHEBI:8386) |
| triamcinolone (CHEBI:9667) has role analgesic (CHEBI:35480) |
| triamcinolone (CHEBI:9667) has role anti-allergic agent (CHEBI:50857) |
| triamcinolone (CHEBI:9667) has role anti-inflammatory agent (CHEBI:67079) |
| triamcinolone (CHEBI:9667) has role anti-inflammatory drug (CHEBI:35472) |
| triamcinolone (CHEBI:9667) has role antineoplastic agent (CHEBI:35610) |
| triamcinolone (CHEBI:9667) has role antipsoriatic (CHEBI:50748) |
| triamcinolone (CHEBI:9667) has role dermatologic drug (CHEBI:50177) |
| triamcinolone (CHEBI:9667) has role nasal decongestant (CHEBI:77715) |
| triamcinolone (CHEBI:9667) has role ophthalmology drug (CHEBI:66981) |
| triamcinolone (CHEBI:9667) is a 11β-hydroxy steroid (CHEBI:35346) |
| triamcinolone (CHEBI:9667) is a 16α-hydroxy steroid (CHEBI:16799) |
| triamcinolone (CHEBI:9667) is a 17α-hydroxy steroid (CHEBI:35342) |
| triamcinolone (CHEBI:9667) is a 20-oxo steroid (CHEBI:36885) |
| triamcinolone (CHEBI:9667) is a 21-hydroxy steroid (CHEBI:35344) |
| triamcinolone (CHEBI:9667) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| triamcinolone (CHEBI:9667) is a C21-steroid hormone (CHEBI:64600) |
| triamcinolone (CHEBI:9667) is a fluorinated steroid (CHEBI:50830) |
| triamcinolone (CHEBI:9667) is a glucocorticoid (CHEBI:24261) |
| triamcinolone (CHEBI:9667) is a primary α-hydroxy ketone (CHEBI:139590) |
| triamcinolone (CHEBI:9667) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| triamcinolone acetonide (CHEBI:71418) has functional parent triamcinolone (CHEBI:9667) |
| IUPAC Name |
|---|
| (11β,16α)-9-fluoro-11,16,17,21-tetrahydroxypregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| triamcinolona | DrugBank |
| triamcinolone | WHO MedNet |
| triamcinolone | KEGG DRUG |
| triamcinolonum | DrugBank |
| Synonyms | Source |
|---|---|
| 11β,16α,17α,21-tetrahydroxy-9α-fluoro-1,4-pregnadiene-3,20-dione | ChemIDplus |
| 9-fluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione | ChemIDplus |
| 9α-fluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione | ChemIDplus |
| 9α-fluoro-11β,16α,17α,21-tetrahydroxypregna-1,4-diene-3,20-dione | NIST Chemistry WebBook |
| 9α-fluoro-16α-hydroxyprednisolone | ChemIDplus |
| Fluoxyprednisolone | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aristocort | ChEMBL |
| Delphicort | ChEMBL |
| Kenacort | ChEMBL |
| Volon | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2725 | DrugCentral |
| D00385 | KEGG DRUG |
| DB00620 | DrugBank |
| HMDB0014758 | HMDB |
| Triamcinolone | Wikipedia |
| WO2005028495 | Patent |
| Citations |
|---|