EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31FO6 |
| Net Charge | 0 |
| Average Mass | 434.504 |
| Monoisotopic Mass | 434.21047 |
| SMILES | [H][C@@]12C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C24H31FO6/c1-20(2)30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,3)23(15,25)17(28)11-22(16,4)24(19,31-20)18(29)12-26/h7-9,15-17,19,26,28H,5-6,10-12H2,1-4H3/t15-,16-,17-,19+,21-,22-,23-,24+/m0/s1 |
| InChIKey | YNDXUCZADRHECN-JNQJZLCISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triamcinolone acetonide (CHEBI:71418) has functional parent triamcinolone (CHEBI:9667) |
| triamcinolone acetonide (CHEBI:71418) has parent hydride pregnane (CHEBI:8386) |
| triamcinolone acetonide (CHEBI:71418) has role anti-allergic agent (CHEBI:50857) |
| triamcinolone acetonide (CHEBI:71418) has role anti-inflammatory drug (CHEBI:35472) |
| triamcinolone acetonide (CHEBI:71418) is a 11β-hydroxy steroid (CHEBI:35346) |
| triamcinolone acetonide (CHEBI:71418) is a 20-oxo steroid (CHEBI:36885) |
| triamcinolone acetonide (CHEBI:71418) is a 21-hydroxy steroid (CHEBI:35344) |
| triamcinolone acetonide (CHEBI:71418) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| triamcinolone acetonide (CHEBI:71418) is a cyclic ketal (CHEBI:59779) |
| triamcinolone acetonide (CHEBI:71418) is a fluorinated steroid (CHEBI:50830) |
| triamcinolone acetonide (CHEBI:71418) is a glucocorticoid (CHEBI:24261) |
| triamcinolone acetonide (CHEBI:71418) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| (4aS,4bR,5S,6aS,6bS,9aR,10aS,10bS)-4b-fluoro-6b-glycoloyl-5-hydroxy-4a,6a,8,8-tetramethyl-4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-dodecahydro-2H-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-2-one |
| Synonyms | Source |
|---|---|
| Triamcinolone 16,17-acetonide | ChemIDplus |
| 9α-fluoro-16α-hydroxyprednisolone 16α,17α-acetonide | ChemIDplus |
| 9α-fluoro-11β,21-dihydroxy-16α,17α-isopropylidenedioxypregna-1,4-diene-3,20-dione | ChemIDplus |
| 9α-fluoro-16α-17α-isopropyledenedioxyprednisolone | ChemIDplus |
| 9α-fluoro-16α-17α-isopropylidenedioxy-Δ-1-hydrocortisone | ChemIDplus |
| 9-fluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione-16,17-acetonide | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| triamcinolone acetonide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08183 | KEGG COMPOUND |
| D00983 | KEGG DRUG |
| DB00620 | DrugBank |
| US2008139545 | Patent |
| US2008118586 | Patent |
| Triamcinolone_acetonide | Wikipedia |
| 2726 | DrugCentral |
| 3009 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:60069 | Reaxys |
| CAS:76-25-5 | KEGG COMPOUND |
| CAS:76-25-5 | ChemIDplus |