EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22ClN5O.HCl |
| Net Charge | 0 |
| Average Mass | 408.333 |
| Monoisotopic Mass | 407.12797 |
| SMILES | Cl.O=c1n(CCCN2CCN(c3cccc(Cl)c3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C19H22ClN5O.ClH/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25;/h1-3,5-7,9,15H,4,8,10-14H2;1H |
| InChIKey | OHHDIOKRWWOXMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trazodone hydrochloride (CHEBI:9655) has part trazodone (CHEBI:9654) |
| trazodone hydrochloride (CHEBI:9655) has role adrenergic antagonist (CHEBI:37887) |
| trazodone hydrochloride (CHEBI:9655) has role antidepressant (CHEBI:35469) |
| trazodone hydrochloride (CHEBI:9655) has role H1-receptor antagonist (CHEBI:37955) |
| trazodone hydrochloride (CHEBI:9655) has role sedative (CHEBI:35717) |
| trazodone hydrochloride (CHEBI:9655) has role serotonin uptake inhibitor (CHEBI:50949) |
| trazodone hydrochloride (CHEBI:9655) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one hydrochloride |
| Synonyms | Source |
|---|---|
| 2-(3-(4-(m-Chlorophenyl)-1-piperazinyl)propyl)-s-triazolo(4,3-a)pyridin-3(2H)-one monohydrochloride | ChemIDplus |
| Trazodone HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Desyrel | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5688374 | Reaxys |
| CAS:25332-39-2 | ChemIDplus |