EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9655 - trazodone hydrochloride
| Formula | C19H22ClN5O.HCl |
| Net Charge | 0 |
| Average Mass | 408.333 |
| Monoisotopic Mass | 407.12797 |
| SMILES | Cl.O=c1n(CCCN2CCN(c3cccc(Cl)c3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C19H22ClN5O.ClH/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25;/h1-3,5-7,9,15H,4,8,10-14H2;1H |
| InChIKey | OHHDIOKRWWOXMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trazodone hydrochloride (CHEBI:9655) has part trazodone (CHEBI:9654) |
| trazodone hydrochloride (CHEBI:9655) has role adrenergic antagonist (CHEBI:37887) |
| trazodone hydrochloride (CHEBI:9655) has role antidepressant (CHEBI:35469) |
| trazodone hydrochloride (CHEBI:9655) has role H1-receptor antagonist (CHEBI:37955) |
| trazodone hydrochloride (CHEBI:9655) has role sedative (CHEBI:35717) |
| trazodone hydrochloride (CHEBI:9655) has role serotonin uptake inhibitor (CHEBI:50949) |
| trazodone hydrochloride (CHEBI:9655) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one hydrochloride |
| Synonyms | Source |
|---|---|
| 2-(3-(4-(m-Chlorophenyl)-1-piperazinyl)propyl)-s-triazolo(4,3-a)pyridin-3(2H)-one monohydrochloride | ChemIDplus |
| AF-1161 | ChEMBL |
| NSC-292811 | ChEMBL |
| Trazodone HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Desyrel | KEGG DRUG |
| Molipaxin | ChEMBL |
| Molipaxin cr | ChEMBL |
| Oleptro | ChEMBL |
| Trialodine | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5688374 | Reaxys |
| CAS:25332-39-2 | ChemIDplus |
| Citations |
|---|