EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9655 - trazodone hydrochloride
| Formula | C19H22ClN5O.HCl |
| Net Charge | 0 |
| Average Mass | 408.333 |
| Monoisotopic Mass | 407.12797 |
| SMILES | Cl.O=c1n(CCCN2CCN(c3cccc(Cl)c3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C19H22ClN5O.ClH/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25;/h1-3,5-7,9,15H,4,8,10-14H2;1H |
| InChIKey | OHHDIOKRWWOXMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trazodone hydrochloride (CHEBI:9655) has part trazodone (CHEBI:9654) |
| trazodone hydrochloride (CHEBI:9655) has role adrenergic antagonist (CHEBI:37887) |
| trazodone hydrochloride (CHEBI:9655) has role antidepressant (CHEBI:35469) |
| trazodone hydrochloride (CHEBI:9655) has role H1-receptor antagonist (CHEBI:37955) |
| trazodone hydrochloride (CHEBI:9655) has role sedative (CHEBI:35717) |
| trazodone hydrochloride (CHEBI:9655) has role serotonin uptake inhibitor (CHEBI:50949) |
| trazodone hydrochloride (CHEBI:9655) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one hydrochloride |
| Synonyms | Source |
|---|---|
| 2-(3-(4-(m-Chlorophenyl)-1-piperazinyl)propyl)-s-triazolo(4,3-a)pyridin-3(2H)-one monohydrochloride | ChemIDplus |
| Trazodone HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Desyrel | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5688374 | Reaxys |
| CAS:25332-39-2 | ChemIDplus |