EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22ClN5O |
| Net Charge | 0 |
| Average Mass | 371.872 |
| Monoisotopic Mass | 371.15129 |
| SMILES | O=c1n(CCCN2CCN(c3cccc(Cl)c3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C19H22ClN5O/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25/h1-3,5-7,9,15H,4,8,10-14H2 |
| InChIKey | PHLBKPHSAVXXEF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trazodone (CHEBI:9654) has role adrenergic antagonist (CHEBI:37887) |
| trazodone (CHEBI:9654) has role antidepressant (CHEBI:35469) |
| trazodone (CHEBI:9654) has role anxiolytic drug (CHEBI:35474) |
| trazodone (CHEBI:9654) has role H1-receptor antagonist (CHEBI:37955) |
| trazodone (CHEBI:9654) has role sedative (CHEBI:35717) |
| trazodone (CHEBI:9654) has role serotonin uptake inhibitor (CHEBI:50949) |
| trazodone (CHEBI:9654) is a N-alkylpiperazine (CHEBI:46845) |
| trazodone (CHEBI:9654) is a N-arylpiperazine (CHEBI:46848) |
| trazodone (CHEBI:9654) is a monochlorobenzenes (CHEBI:83403) |
| trazodone (CHEBI:9654) is a triazolopyridine (CHEBI:46746) |
| Incoming Relation(s) |
| trazodone hydrochloride (CHEBI:9655) has part trazodone (CHEBI:9654) |
| IUPAC Name |
|---|
| 2-{3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one |
| INNs | Source |
|---|---|
| trazodona | ChEBI |
| trazodone | ChEBI |
| trazodonum | ChEBI |
| Synonyms | Source |
|---|---|
| 2-(3-[4-(3-chlorophenyl)-1-piperazinyl]propyl)[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one | NIST Chemistry WebBook |
| Trazodone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:628010 | Beilstein |
| CAS:19794-93-5 | NIST Chemistry WebBook |
| CAS:19794-93-5 | ChemIDplus |