EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N2O5 |
| Net Charge | 0 |
| Average Mass | 430.545 |
| Monoisotopic Mass | 430.24677 |
| SMILES | [H][C@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C24H34N2O5/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29)/t16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | VXFJYXUZANRPDJ-WTNASJBWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trandolapril (CHEBI:9649) has functional parent trandolaprilat (CHEBI:141521) |
| trandolapril (CHEBI:9649) has role antihypertensive agent (CHEBI:35674) |
| trandolapril (CHEBI:9649) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| trandolapril (CHEBI:9649) has role prodrug (CHEBI:50266) |
| trandolapril (CHEBI:9649) is a dicarboxylic acid monoester (CHEBI:36244) |
| trandolapril (CHEBI:9649) is a dipeptide (CHEBI:46761) |
| trandolapril (CHEBI:9649) is a ethyl ester (CHEBI:23990) |
| trandolapril (CHEBI:9649) is a organic heterobicyclic compound (CHEBI:27171) |
| trandolapril (CHEBI:9649) is a secondary amino compound (CHEBI:50995) |
| trandolapril (CHEBI:9649) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2S,3aR,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid |
| INNs | Source |
|---|---|
| trandolapril | WHO MedNet |
| trandolapril | WHO MedNet |
| trandolapril | WHO MedNet |
| trandolaprilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S,3aR,7aS)-1-((S)-N-((S)-1-carboxy-3-phenylpropyl)alanyl)hexahydro-2-indolinecarboxylic acid, 1-ethyl ester | ChemIDplus |
| RU 44570 | ChemIDplus |
| RU-44570 | ChEBI |
| RU44570 | ChEBI |
| Brand Names | Source |
|---|---|
| Gopten | ChemIDplus |
| Mavik | ChemIDplus |
| Odrik | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2712 | DrugCentral |
| 4588590 | ChemSpider |
| D00383 | KEGG DRUG |
| DB00519 | DrugBank |
| HMDB0014660 | HMDB |
| KR20080046630 | Patent |
| Trandolapril | Wikipedia |
| WO2006014916 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8655766 | Reaxys |
| CAS:87679-37-6 | KEGG COMPOUND |
| CAS:87679-37-6 | ChemIDplus |
| Citations |
|---|