EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O5 |
| Net Charge | 0 |
| Average Mass | 402.491 |
| Monoisotopic Mass | 402.21547 |
| SMILES | [H][C@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)O)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C22H30N2O5/c1-14(23-17(21(26)27)12-11-15-7-3-2-4-8-15)20(25)24-18-10-6-5-9-16(18)13-19(24)22(28)29/h2-4,7-8,14,16-19,23H,5-6,9-13H2,1H3,(H,26,27)(H,28,29)/t14-,16+,17-,18-,19-/m0/s1 |
| InChIKey | AHYHTSYNOHNUSH-HXFGRODQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (17117442) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trandolaprilat (CHEBI:141521) has role antihypertensive agent (CHEBI:35674) |
| trandolaprilat (CHEBI:141521) has role drug metabolite (CHEBI:49103) |
| trandolaprilat (CHEBI:141521) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| trandolaprilat (CHEBI:141521) has role human xenobiotic metabolite (CHEBI:76967) |
| trandolaprilat (CHEBI:141521) is a dicarboxylic acid (CHEBI:35692) |
| trandolaprilat (CHEBI:141521) is a dipeptide (CHEBI:46761) |
| trandolaprilat (CHEBI:141521) is a organic heterobicyclic compound (CHEBI:27171) |
| trandolaprilat (CHEBI:141521) is a secondary amino compound (CHEBI:50995) |
| trandolaprilat (CHEBI:141521) is a tertiary carboxamide (CHEBI:140326) |
| Incoming Relation(s) |
| trandolapril (CHEBI:9649) has functional parent trandolaprilat (CHEBI:141521) |
| IUPAC Name |
|---|
| (2S,3aR,7aS)-1-[(2S)-2-{[(1S)-1-carboxy-3-phenylpropyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid |
| INNs | Source |
|---|---|
| trandolaprilat | WHO MedNet |
| trandolaprilat | WHO MedNet |
| trandolaprilate | WHO MedNet |
| trandolaprilatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(2-((1-carboxy-3-phenylpropyl)amino)-1-oxopropyl)octahydro-1H-indole-2-carboxylic acid | HMDB |
| (2S,3aR,7aS)-1-((S)-N-((S)-1-carboxy-3-phenylpropyl)alanyl)hexahydro-2-indolinecarboxylic acid | ChemIDplus |
| RU 44403 | ChemIDplus |
| RU-44403 | ChEBI |
| RU44403 | ChEBI |
| trandolapril diacid | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 4576532 | ChemSpider |
| C21515 | KEGG COMPOUND |
| CN101302185 | Patent |
| CN101460459 | Patent |
| DB14209 | DrugBank |
| HMDB0060583 | HMDB |
| X93 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8875886 | Reaxys |
| CAS:87679-71-8 | ChemIDplus |
| Citations |
|---|